C19H38O2 — CID 143286899
6-[2-butyl-3-(1-hydroxyethyl)-2-methylcyclopentyl]-2-methylhexan-2-ol (PubChem CID 143286899) has the molecular formula C19H38O2 and a molecular weight of 298.51 g/mol. Its IUPAC name is 6-[2-butyl-3-(1-hydroxyethyl)-2-methylcyclopentyl]-2-methylhexan-2-ol.
| Compound Name | 6-[2-butyl-3-(1-hydroxyethyl)-2-methylcyclopentyl]-2-methylhexan-2-ol |
|---|---|
| PubChem CID | 143286899 |
| Molecular Formula | C19H38O2 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.29 |
| IUPAC Name | 6-[2-butyl-3-(1-hydroxyethyl)-2-methylcyclopentyl]-2-methylhexan-2-ol |
| SMILES | CCCCC1(C)C(CCCCC(C)(C)O)CCC1C(C)O |
| InChI | InChI=1S/C19H38O2/c1-6-7-14-19(5)16(11-12-17(19)15(2)20)10-8-9-13-18(3,4)21/h15-17,20-21H,6-14H2,1-5H3 |
| InChIKey | ALDAWAKLAWNNGF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|