C33H58O2Si — CID 164929826
(6R)-6-[(3S,10R,13R)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-ol (PubChem CID 164929826) has the molecular formula C33H58O2Si and a molecular weight of 514.91 g/mol. Its IUPAC name is (6R)-6-[(3S,10R,13R)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-ol.
| Compound Name | (6R)-6-[(3S,10R,13R)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 164929826 |
| Molecular Formula | C33H58O2Si |
| Molecular Weight | 514.91 g/mol |
| Exact Mass | 514.42 |
| IUPAC Name | (6R)-6-[(3S,10R,13R)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-ol |
| SMILES | C[C@H](CCCC(C)(C)O)C1CCC2C3=CC=C4C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C33H58O2Si/c1-23(12-11-19-31(5,6)34)27-15-16-28-26-14-13-24-22-25(35-36(9,10)30(2,3)4)17-20-32(24,7)29(26)18-21-33(27,28)8/h13-14,23,25,27-29,34H,11-12,15-22H2,1-10H3/t23-,25+,27?,28?,29?,32+,33-/m1/s1 |
| InChIKey | DJRGLSFCMPCAME-TXGFWOBZSA-N |
| XLogP | 9.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.91 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|