C41H52O4 — CID 125036608
[(3R,9S,10R,13S,14S,17S)-17-[(2R)-6-benzoyloxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 125036608) has the molecular formula C41H52O4 and a molecular weight of 608.86 g/mol. Its IUPAC name is [(3R,9S,10R,13S,14S,17S)-17-[(2R)-6-benzoyloxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(3R,9S,10R,13S,14S,17S)-17-[(2R)-6-benzoyloxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 125036608 |
| Molecular Formula | C41H52O4 |
| Molecular Weight | 608.86 g/mol |
| Exact Mass | 608.39 |
| IUPAC Name | [(3R,9S,10R,13S,14S,17S)-17-[(2R)-6-benzoyloxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | C[C@H](CCCC(C)(C)OC(=O)c1ccccc1)[C@@H]1CC[C@@H]2C3=CC=C4C[C@H](OC(=O)c5ccccc5)CC[C@]4(C)[C@H]3CC[C@]21C |
| InChI | InChI=1S/C41H52O4/c1-28(13-12-24-39(2,3)45-38(43)30-16-10-7-11-17-30)34-20-21-35-33-19-18-31-27-32(44-37(42)29-14-8-6-9-15-29)22-25-40(31,4)36(33)23-26-41(34,35)5/h6-11,14-19,28,32,34-36H,12-13,20-27H2,1-5H3/t28-,32-,34+,35-,36+,40+,41+/m1/s1 |
| InChIKey | XOLOXGNFZBJRJO-WEAUXJCZSA-N |
| XLogP | 10.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.86 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |