C33H52O7S — CID 139747219
2-[(1S,3R,9S,10R,13R,14R,17R)-10,13-dimethyl-1,3-bis(oxan-2-yloxy)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl methanesulfonate (PubChem CID 139747219) has the molecular formula C33H52O7S and a molecular weight of 592.84 g/mol. Its IUPAC name is 2-[(1S,3R,9S,10R,13R,14R,17R)-10,13-dimethyl-1,3-bis(oxan-2-yloxy)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl methanesulfonate.
| Compound Name | 2-[(1S,3R,9S,10R,13R,14R,17R)-10,13-dimethyl-1,3-bis(oxan-2-yloxy)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl methanesulfonate |
|---|---|
| PubChem CID | 139747219 |
| Molecular Formula | C33H52O7S |
| Molecular Weight | 592.84 g/mol |
| Exact Mass | 592.34 |
| IUPAC Name | 2-[(1S,3R,9S,10R,13R,14R,17R)-10,13-dimethyl-1,3-bis(oxan-2-yloxy)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl methanesulfonate |
| SMILES | CC(COS(C)(=O)=O)[C@H]1CC[C@H]2C3=CC=C4C[C@@H](OC5CCCCO5)C[C@H](OC5CCCCO5)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H52O7S/c1-22(21-38-41(4,34)35)26-13-14-27-25-12-11-23-19-24(39-30-9-5-7-17-36-30)20-29(40-31-10-6-8-18-37-31)33(23,3)28(25)15-16-32(26,27)2/h11-12,22,24,26-31H,5-10,13-21H2,1-4H3/t22?,24-,26-,27+,28+,29+,30?,31?,32-,33+/m1/s1 |
| InChIKey | JXHUTKNMOWVBGP-AWQUWCLOSA-N |
| XLogP | 6.53 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.84 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|