C33H52O3 — CID 142521842
(2S,5S)-2-[(3S,10R,13R)-10,13-dimethyl-3-(oxan-2-yloxy)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-5,6-dimethylheptan-3-one (PubChem CID 142521842) has the molecular formula C33H52O3 and a molecular weight of 496.78 g/mol. Its IUPAC name is (2S,5S)-2-[(3S,10R,13R)-10,13-dimethyl-3-(oxan-2-yloxy)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-5,6-dimethylheptan-3-one.
| Compound Name | (2S,5S)-2-[(3S,10R,13R)-10,13-dimethyl-3-(oxan-2-yloxy)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-5,6-dimethylheptan-3-one |
|---|---|
| PubChem CID | 142521842 |
| Molecular Formula | C33H52O3 |
| Molecular Weight | 496.78 g/mol |
| Exact Mass | 496.39 |
| IUPAC Name | (2S,5S)-2-[(3S,10R,13R)-10,13-dimethyl-3-(oxan-2-yloxy)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-5,6-dimethylheptan-3-one |
| SMILES | CC(C)[C@@H](C)CC(=O)[C@@H](C)C1CCC2C3=CC=C4C[C@@H](OC5CCCCO5)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C33H52O3/c1-21(2)22(3)19-30(34)23(4)27-12-13-28-26-11-10-24-20-25(36-31-9-7-8-18-35-31)14-16-32(24,5)29(26)15-17-33(27,28)6/h10-11,21-23,25,27-29,31H,7-9,12-20H2,1-6H3/t22-,23-,25-,27?,28?,29?,31?,32-,33+/m0/s1 |
| InChIKey | MOMFJXRMZRKESF-KEBYBHBJSA-N |
| XLogP | 8.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.78 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |