C32H52O4 — CID 70528825
(3R,6R)-6-[(9S,10R,13R,14R,17R)-10,13-dimethyl-3-(oxan-3-yloxy)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptane-2,3-diol (PubChem CID 70528825) has the molecular formula C32H52O4 and a molecular weight of 500.76 g/mol. Its IUPAC name is (3R,6R)-6-[(9S,10R,13R,14R,17R)-10,13-dimethyl-3-(oxan-3-yloxy)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptane-2,3-diol.
| Compound Name | (3R,6R)-6-[(9S,10R,13R,14R,17R)-10,13-dimethyl-3-(oxan-3-yloxy)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptane-2,3-diol |
|---|---|
| PubChem CID | 70528825 |
| Molecular Formula | C32H52O4 |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | (3R,6R)-6-[(9S,10R,13R,14R,17R)-10,13-dimethyl-3-(oxan-3-yloxy)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptane-2,3-diol |
| SMILES | C[C@H](CC[C@@H](O)C(C)(C)O)[C@H]1CC[C@H]2C3=CC=C4CC(OC5CCCOC5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C32H52O4/c1-21(8-13-29(33)30(2,3)34)26-11-12-27-25-10-9-22-19-23(36-24-7-6-18-35-20-24)14-16-31(22,4)28(25)15-17-32(26,27)5/h9-10,21,23-24,26-29,33-34H,6-8,11-20H2,1-5H3/t21-,23?,24?,26-,27+,28+,29-,31+,32-/m1/s1 |
| InChIKey | ZBPCDUILARUFIQ-VOTPIVSKSA-N |
| XLogP | 6.60 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |