C37H60O6 — CID 148700593
1-O-[(3S,10R,13R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-O-[2-(2-methoxyethoxy)ethyl] 2-methylbutanedioate (PubChem CID 148700593) has the molecular formula C37H60O6 and a molecular weight of 600.88 g/mol. Its IUPAC name is 1-O-[(3S,10R,13R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-O-[2-(2-methoxyethoxy)ethyl] 2-methylbutanedioate.
| Compound Name | 1-O-[(3S,10R,13R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-O-[2-(2-methoxyethoxy)ethyl] 2-methylbutanedioate |
|---|---|
| PubChem CID | 148700593 |
| Molecular Formula | C37H60O6 |
| Molecular Weight | 600.88 g/mol |
| Exact Mass | 600.44 |
| IUPAC Name | 1-O-[(3S,10R,13R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-O-[2-(2-methoxyethoxy)ethyl] 2-methylbutanedioate |
| SMILES | COCCOCCOC(=O)CC(C)C(=O)O[C@H]1CC[C@@]2(C)C(=CC=C3C4CCC([C@H](C)CCCC(C)C)[C@@]4(C)CCC32)C1 |
| InChI | InChI=1S/C37H60O6/c1-25(2)9-8-10-26(3)31-13-14-32-30-12-11-28-24-29(15-17-36(28,5)33(30)16-18-37(31,32)6)43-35(39)27(4)23-34(38)42-22-21-41-20-19-40-7/h11-12,25-27,29,31-33H,8-10,13-24H2,1-7H3/t26-,27?,29+,31?,32?,33?,36+,37-/m1/s1 |
| InChIKey | NVHGTOZJWNHDTA-BIGJLSHPSA-N |
| XLogP | 8.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.88 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|