C31H50O5 — CID 67609595
[(7R)-7-[(3S,5S,10R,13R,14R,17R)-3-(methoxymethoxy)-10,13-dimethyl-6-oxo-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]octyl] acetate (PubChem CID 67609595) has the molecular formula C31H50O5 and a molecular weight of 502.74 g/mol. Its IUPAC name is [(7R)-7-[(3S,5S,10R,13R,14R,17R)-3-(methoxymethoxy)-10,13-dimethyl-6-oxo-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]octyl] acetate.
| Compound Name | [(7R)-7-[(3S,5S,10R,13R,14R,17R)-3-(methoxymethoxy)-10,13-dimethyl-6-oxo-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]octyl] acetate |
|---|---|
| PubChem CID | 67609595 |
| Molecular Formula | C31H50O5 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.37 |
| IUPAC Name | [(7R)-7-[(3S,5S,10R,13R,14R,17R)-3-(methoxymethoxy)-10,13-dimethyl-6-oxo-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]octyl] acetate |
| SMILES | COCO[C@H]1CC[C@]2(C)C3CC[C@]4(C)[C@@H]([C@H](C)CCCCCCOC(C)=O)CC[C@H]4C3=CC(=O)[C@H]2C1 |
| InChI | InChI=1S/C31H50O5/c1-21(10-8-6-7-9-17-35-22(2)32)25-11-12-26-24-19-29(33)28-18-23(36-20-34-5)13-15-31(28,4)27(24)14-16-30(25,26)3/h19,21,23,25-28H,6-18,20H2,1-5H3/t21-,23+,25-,26+,27?,28-,30-,31-/m1/s1 |
| InChIKey | BBMXBXGJYJTHSQ-JVBZLWHDSA-N |
| XLogP | 6.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|