C33H54O4Si — CID 151807340
tert-butyl 2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(9S,10R,13S,14S)-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]acetate (PubChem CID 151807340) has the molecular formula C33H54O4Si and a molecular weight of 542.88 g/mol. Its IUPAC name is tert-butyl 2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(9S,10R,13S,14S)-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]acetate.
| Compound Name | tert-butyl 2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(9S,10R,13S,14S)-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]acetate |
|---|---|
| PubChem CID | 151807340 |
| Molecular Formula | C33H54O4Si |
| Molecular Weight | 542.88 g/mol |
| Exact Mass | 542.38 |
| IUPAC Name | tert-butyl 2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(9S,10R,13S,14S)-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy]acetate |
| SMILES | CC(C)(C)OC(=O)CO[C@@H](CO[Si](C)(C)C(C)(C)C)C1=CC[C@H]2C3=CC=C4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H54O4Si/c1-30(2,3)37-29(34)22-35-28(21-36-38(9,10)31(4,5)6)27-17-16-25-24-15-14-23-13-11-12-19-32(23,7)26(24)18-20-33(25,27)8/h14-15,17,25-26,28H,11-13,16,18-22H2,1-10H3/t25-,26-,28-,32-,33-/m0/s1 |
| InChIKey | RZWOWUZWPKAFPQ-MHMCFALESA-N |
| XLogP | 8.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.88 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|