C27H44O3 — CID 154089397
(2S,6R)-6-[(9S,10R,13R,14R,17R)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptane-1,1,1-triol (PubChem CID 154089397) has the molecular formula C27H44O3 and a molecular weight of 416.65 g/mol. Its IUPAC name is (2S,6R)-6-[(9S,10R,13R,14R,17R)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptane-1,1,1-triol.
| Compound Name | (2S,6R)-6-[(9S,10R,13R,14R,17R)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptane-1,1,1-triol |
|---|---|
| PubChem CID | 154089397 |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | (2S,6R)-6-[(9S,10R,13R,14R,17R)-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptane-1,1,1-triol |
| SMILES | C[C@H](CCC[C@H](C)C(O)(O)O)[C@H]1CC[C@H]2C3=CC=C4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H44O3/c1-18(8-7-9-19(2)27(28,29)30)22-13-14-23-21-12-11-20-10-5-6-16-25(20,3)24(21)15-17-26(22,23)4/h11-12,18-19,22-24,28-30H,5-10,13-17H2,1-4H3/t18-,19+,22-,23+,24+,25+,26-/m1/s1 |
| InChIKey | BYKJMKQYVPSYFK-BDSVZTEVSA-N |
| XLogP | 5.95 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|