C13H20OSi — CID 25179994
(1S,2S,3S,6R,7R)-4-trimethylsilyltricyclo[5.2.1.02,6]deca-4,8-dien-3-ol (PubChem CID 25179994) has the molecular formula C13H20OSi and a molecular weight of 220.39 g/mol. Its IUPAC name is (1S,2S,3S,6R,7R)-4-trimethylsilyltricyclo[5.2.1.02,6]deca-4,8-dien-3-ol.
| Compound Name | (1S,2S,3S,6R,7R)-4-trimethylsilyltricyclo[5.2.1.02,6]deca-4,8-dien-3-ol |
|---|---|
| PubChem CID | 25179994 |
| Molecular Formula | C13H20OSi |
| Molecular Weight | 220.39 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (1S,2S,3S,6R,7R)-4-trimethylsilyltricyclo[5.2.1.02,6]deca-4,8-dien-3-ol |
| SMILES | C[Si](C)(C)C1=C[C@H]2[C@H]([C@@H]3C=C[C@H]2C3)[C@@H]1O |
| InChI | InChI=1S/C13H20OSi/c1-15(2,3)11-7-10-8-4-5-9(6-8)12(10)13(11)14/h4-5,7-10,12-14H,6H2,1-3H3/t8-,9+,10+,12-,13+/m0/s1 |
| InChIKey | KPZALKPUULDLRI-YQPPGCHHSA-N |
| XLogP | 2.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|