C21H34O — CID 101071845
(1R,2R,3S,6R,7S)-4-undecyltricyclo[5.2.1.02,6]deca-4,8-dien-3-ol (PubChem CID 101071845) has the molecular formula C21H34O and a molecular weight of 302.50 g/mol. Its IUPAC name is (1R,2R,3S,6R,7S)-4-undecyltricyclo[5.2.1.02,6]deca-4,8-dien-3-ol.
| Compound Name | (1R,2R,3S,6R,7S)-4-undecyltricyclo[5.2.1.02,6]deca-4,8-dien-3-ol |
|---|---|
| PubChem CID | 101071845 |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | (1R,2R,3S,6R,7S)-4-undecyltricyclo[5.2.1.02,6]deca-4,8-dien-3-ol |
| SMILES | CCCCCCCCCCCC1=C[C@@H]2[C@H]([C@@H]1O)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C21H34O/c1-2-3-4-5-6-7-8-9-10-11-18-15-19-16-12-13-17(14-16)20(19)21(18)22/h12-13,15-17,19-22H,2-11,14H2,1H3/t16-,17+,19+,20-,21-/m1/s1 |
| InChIKey | ZCOXHDNXGBCHJB-KZEVZHLLSA-N |
| XLogP | 5.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|