C16H26O2 — CID 10634454
(1S,4R)-5-octylbicyclo[2.2.2]octa-5,7-diene-2,3-diol (PubChem CID 10634454) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (1S,4R)-5-octylbicyclo[2.2.2]octa-5,7-diene-2,3-diol.
| Compound Name | (1S,4R)-5-octylbicyclo[2.2.2]octa-5,7-diene-2,3-diol |
|---|---|
| PubChem CID | 10634454 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (1S,4R)-5-octylbicyclo[2.2.2]octa-5,7-diene-2,3-diol |
| SMILES | CCCCCCCCC1=C[C@@H]2C=C[C@H]1C(O)C2O |
| InChI | InChI=1S/C16H26O2/c1-2-3-4-5-6-7-8-12-11-13-9-10-14(12)16(18)15(13)17/h9-11,13-18H,2-8H2,1H3/t13-,14+,15?,16?/m0/s1 |
| InChIKey | CQYPZMMVWSDINA-QRNKSROTSA-N |
| XLogP | 3.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|