C16H28O — CID 135055154
1-[(1S,3aS,6aR)-2-pentyl-1,3a,4,5,6,6a-hexahydropentalen-1-yl]propan-1-ol (PubChem CID 135055154) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is 1-[(1S,3aS,6aR)-2-pentyl-1,3a,4,5,6,6a-hexahydropentalen-1-yl]propan-1-ol.
| Compound Name | 1-[(1S,3aS,6aR)-2-pentyl-1,3a,4,5,6,6a-hexahydropentalen-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 135055154 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | 1-[(1S,3aS,6aR)-2-pentyl-1,3a,4,5,6,6a-hexahydropentalen-1-yl]propan-1-ol |
| SMILES | CCCCCC1=C[C@H]2CCC[C@H]2[C@@H]1C(O)CC |
| InChI | InChI=1S/C16H28O/c1-3-5-6-8-13-11-12-9-7-10-14(12)16(13)15(17)4-2/h11-12,14-17H,3-10H2,1-2H3/t12-,14-,15?,16-/m1/s1 |
| InChIKey | NMMZOLLAYIFKDV-FZLHRTGXSA-N |
| XLogP | 4.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|