C46H76N2 — CID 70651316
4-[4-[4-[4-(4-aminocyclohex-2-en-1-yl)-5-ethylcyclohex-2-en-1-yl]-2,5-dihexylcyclohex-2-en-1-yl]-6-ethylcyclohex-2-en-1-yl]cyclohex-2-en-1-amine (PubChem CID 70651316) has the molecular formula C46H76N2 and a molecular weight of 657.13 g/mol. Its IUPAC name is 4-[4-[4-[4-(4-aminocyclohex-2-en-1-yl)-5-ethylcyclohex-2-en-1-yl]-2,5-dihexylcyclohex-2-en-1-yl]-6-ethylcyclohex-2-en-1-yl]cyclohex-2-en-1-amine.
| Compound Name | 4-[4-[4-[4-(4-aminocyclohex-2-en-1-yl)-5-ethylcyclohex-2-en-1-yl]-2,5-dihexylcyclohex-2-en-1-yl]-6-ethylcyclohex-2-en-1-yl]cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 70651316 |
| Molecular Formula | C46H76N2 |
| Molecular Weight | 657.13 g/mol |
| Exact Mass | 656.60 |
| IUPAC Name | 4-[4-[4-[4-(4-aminocyclohex-2-en-1-yl)-5-ethylcyclohex-2-en-1-yl]-2,5-dihexylcyclohex-2-en-1-yl]-6-ethylcyclohex-2-en-1-yl]cyclohex-2-en-1-amine |
| SMILES | CCCCCCC1=CC(C2C=CC(C3C=CC(N)CC3)C(CC)C2)C(CCCCCC)CC1C1C=CC(C2C=CC(N)CC2)C(CC)C1 |
| InChI | InChI=1S/C46H76N2/c1-5-9-11-13-15-37-31-46(40-22-28-44(34(8-4)30-40)36-19-25-42(48)26-20-36)38(16-14-12-10-6-2)32-45(37)39-21-27-43(33(7-3)29-39)35-17-23-41(47)24-18-35/h17,19,21-23,25,27-28,31,33-36,38-46H,5-16,18,20,24,26,29-30,32,47-48H2,1-4H3 |
| InChIKey | YUISMDNSDKGOES-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.13 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|