C39H68O3 — CID 175618201
8-[6,7-dihexyl-2-(8-oxononyl)-1,2,4a,5,6,8a-hexahydronaphthalen-1-yl]octanoic acid (PubChem CID 175618201) has the molecular formula C39H68O3 and a molecular weight of 584.97 g/mol. Its IUPAC name is 8-[6,7-dihexyl-2-(8-oxononyl)-1,2,4a,5,6,8a-hexahydronaphthalen-1-yl]octanoic acid.
| Compound Name | 8-[6,7-dihexyl-2-(8-oxononyl)-1,2,4a,5,6,8a-hexahydronaphthalen-1-yl]octanoic acid |
|---|---|
| PubChem CID | 175618201 |
| Molecular Formula | C39H68O3 |
| Molecular Weight | 584.97 g/mol |
| Exact Mass | 584.52 |
| IUPAC Name | 8-[6,7-dihexyl-2-(8-oxononyl)-1,2,4a,5,6,8a-hexahydronaphthalen-1-yl]octanoic acid |
| SMILES | CCCCCCC1=CC2C(C=CC(CCCCCCCC(C)=O)C2CCCCCCCC(=O)O)CC1CCCCCC |
| InChI | InChI=1S/C39H68O3/c1-4-6-8-17-24-34-30-36-29-28-33(23-19-13-10-12-16-22-32(3)40)37(26-20-14-11-15-21-27-39(41)42)38(36)31-35(34)25-18-9-7-5-2/h28-29,31,33-34,36-38H,4-27,30H2,1-3H3,(H,41,42) |
| InChIKey | FZKSQAYIQIVOSX-UHFFFAOYSA-N |
| XLogP | 12.04 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.97 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|