C38H65NO4 — CID 146507696
8-[6,7-dihexyl-1-(8-nitroso-8-oxooctyl)-1,2,4a,5,6,8a-hexahydronaphthalen-2-yl]octanoic acid (PubChem CID 146507696) has the molecular formula C38H65NO4 and a molecular weight of 599.94 g/mol. Its IUPAC name is 8-[6,7-dihexyl-1-(8-nitroso-8-oxooctyl)-1,2,4a,5,6,8a-hexahydronaphthalen-2-yl]octanoic acid.
| Compound Name | 8-[6,7-dihexyl-1-(8-nitroso-8-oxooctyl)-1,2,4a,5,6,8a-hexahydronaphthalen-2-yl]octanoic acid |
|---|---|
| PubChem CID | 146507696 |
| Molecular Formula | C38H65NO4 |
| Molecular Weight | 599.94 g/mol |
| Exact Mass | 599.49 |
| IUPAC Name | 8-[6,7-dihexyl-1-(8-nitroso-8-oxooctyl)-1,2,4a,5,6,8a-hexahydronaphthalen-2-yl]octanoic acid |
| SMILES | CCCCCCC1=CC2C(C=CC(CCCCCCCC(=O)O)C2CCCCCCCC(=O)N=O)CC1CCCCCC |
| InChI | InChI=1S/C38H65NO4/c1-3-5-7-15-22-32-29-34-28-27-31(21-17-11-9-14-20-26-38(41)42)35(24-18-12-10-13-19-25-37(40)39-43)36(34)30-33(32)23-16-8-6-4-2/h27-28,30-32,34-36H,3-26,29H2,1-2H3,(H,41,42) |
| InChIKey | HDQIAOBVUZPCPN-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.94 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|