C15H28Si2 — CID 101474513
trimethyl-[(1S,2S,3R,4R,5R,6R)-4-trimethylsilyl-3-tricyclo[4.2.1.02,5]non-7-enyl]silane (PubChem CID 101474513) has the molecular formula C15H28Si2 and a molecular weight of 264.56 g/mol. Its IUPAC name is trimethyl-[(1S,2S,3R,4R,5R,6R)-4-trimethylsilyl-3-tricyclo[4.2.1.02,5]non-7-enyl]silane.
| Compound Name | trimethyl-[(1S,2S,3R,4R,5R,6R)-4-trimethylsilyl-3-tricyclo[4.2.1.02,5]non-7-enyl]silane |
|---|---|
| PubChem CID | 101474513 |
| Molecular Formula | C15H28Si2 |
| Molecular Weight | 264.56 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | trimethyl-[(1S,2S,3R,4R,5R,6R)-4-trimethylsilyl-3-tricyclo[4.2.1.02,5]non-7-enyl]silane |
| SMILES | C[Si](C)(C)[C@@H]1[C@H]2[C@@H]([C@H]1[Si](C)(C)C)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C15H28Si2/c1-16(2,3)14-12-10-7-8-11(9-10)13(12)15(14)17(4,5)6/h7-8,10-15H,9H2,1-6H3/t10-,11+,12+,13-,14-,15-/m1/s1 |
| InChIKey | KYXODICYPBTKDB-YXJLRHLOSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|