C13H22O2SSi — CID 134898114
trimethyl-[(3R,5R)-5-methyl-4,4-dioxo-4λ6-thiatricyclo[5.2.1.02,6]dec-8-en-3-yl]silane (PubChem CID 134898114) has the molecular formula C13H22O2SSi and a molecular weight of 270.47 g/mol. Its IUPAC name is trimethyl-[(3R,5R)-5-methyl-4,4-dioxo-4λ6-thiatricyclo[5.2.1.02,6]dec-8-en-3-yl]silane.
| Compound Name | trimethyl-[(3R,5R)-5-methyl-4,4-dioxo-4λ6-thiatricyclo[5.2.1.02,6]dec-8-en-3-yl]silane |
|---|---|
| PubChem CID | 134898114 |
| Molecular Formula | C13H22O2SSi |
| Molecular Weight | 270.47 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | trimethyl-[(3R,5R)-5-methyl-4,4-dioxo-4λ6-thiatricyclo[5.2.1.02,6]dec-8-en-3-yl]silane |
| SMILES | CC1C2C3C=CC(C3)C2C([Si](C)(C)C)S1(=O)=O |
| InChI | InChI=1S/C13H22O2SSi/c1-8-11-9-5-6-10(7-9)12(11)13(16(8,14)15)17(2,3)4/h5-6,8-13H,7H2,1-4H3 |
| InChIKey | QIFIAYLZHLWHEV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|