C15H20O2S — CID 155929168
(2R,3S,5R,6S)-3,5-bis(prop-2-enyl)-4λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 4,4-dioxide (PubChem CID 155929168) has the molecular formula C15H20O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is (2R,3S,5R,6S)-3,5-bis(prop-2-enyl)-4λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 4,4-dioxide.
| Compound Name | (2R,3S,5R,6S)-3,5-bis(prop-2-enyl)-4λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 4,4-dioxide |
|---|---|
| PubChem CID | 155929168 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (2R,3S,5R,6S)-3,5-bis(prop-2-enyl)-4λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 4,4-dioxide |
| SMILES | C=CC[C@@H]1[C@H]2C3C=CC(C3)[C@H]2[C@H](CC=C)S1(=O)=O |
| InChI | InChI=1S/C15H20O2S/c1-3-5-12-14-10-7-8-11(9-10)15(14)13(6-4-2)18(12,16)17/h3-4,7-8,10-15H,1-2,5-6,9H2/t10?,11?,12-,13+,14-,15+ |
| InChIKey | IOGMXXRWRLNQSN-ZOONQSOGSA-N |
| XLogP | 2.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|