C19H28O2S — CID 155929169
(1S,3R,4S,5R,7S,8Z,13R)-5-ethenyl-3-pent-4-enyl-2λ6-thiatricyclo[5.5.1.04,13]tridec-8-ene 2,2-dioxide (PubChem CID 155929169) has the molecular formula C19H28O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is (1S,3R,4S,5R,7S,8Z,13R)-5-ethenyl-3-pent-4-enyl-2λ6-thiatricyclo[5.5.1.04,13]tridec-8-ene 2,2-dioxide.
| Compound Name | (1S,3R,4S,5R,7S,8Z,13R)-5-ethenyl-3-pent-4-enyl-2λ6-thiatricyclo[5.5.1.04,13]tridec-8-ene 2,2-dioxide |
|---|---|
| PubChem CID | 155929169 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (1S,3R,4S,5R,7S,8Z,13R)-5-ethenyl-3-pent-4-enyl-2λ6-thiatricyclo[5.5.1.04,13]tridec-8-ene 2,2-dioxide |
| SMILES | C=CCCC[C@@H]1[C@@H]2[C@H]3[C@H](/C=C\CCC[C@@H]3S1(=O)=O)C[C@@H]2C=C |
| InChI | InChI=1S/C19H28O2S/c1-3-5-7-11-16-18-14(4-2)13-15-10-8-6-9-12-17(19(15)18)22(16,20)21/h3-4,8,10,14-19H,1-2,5-7,9,11-13H2/b10-8-/t14-,15+,16+,17-,18+,19-/m0/s1 |
| InChIKey | MPFZKUASHFQRFN-FCAIUVHJSA-N |
| XLogP | 4.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|