C15H20O2S — CID 122205119
(1S,6S,8R,13R,14S,15R)-7λ6-thiatetracyclo[11.2.1.06,15.08,14]hexadeca-2,11-diene 7,7-dioxide (PubChem CID 122205119) has the molecular formula C15H20O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is (1S,6S,8R,13R,14S,15R)-7λ6-thiatetracyclo[11.2.1.06,15.08,14]hexadeca-2,11-diene 7,7-dioxide.
| Compound Name | (1S,6S,8R,13R,14S,15R)-7λ6-thiatetracyclo[11.2.1.06,15.08,14]hexadeca-2,11-diene 7,7-dioxide |
|---|---|
| PubChem CID | 122205119 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (1S,6S,8R,13R,14S,15R)-7λ6-thiatetracyclo[11.2.1.06,15.08,14]hexadeca-2,11-diene 7,7-dioxide |
| SMILES | O=S1(=O)[C@@H]2CCC=C[C@H]3C[C@H]4C=CCC[C@H]1[C@H]4[C@@H]23 |
| InChI | InChI=1S/C15H20O2S/c16-18(17)12-7-3-1-5-10-9-11-6-2-4-8-13(18)15(11)14(10)12/h1-2,5-6,10-15H,3-4,7-9H2/t10-,11+,12+,13-,14+,15- |
| InChIKey | LXPYSJSOQWZQMN-FYYZZUKCSA-N |
| XLogP | 2.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|