C17H24O2S — CID 155929175
(1S,2Z,7S,9R,13Z,15R,16S,17R)-8λ6-thiatetracyclo[13.2.1.07,17.09,16]octadeca-2,13-diene 8,8-dioxide (PubChem CID 155929175) has the molecular formula C17H24O2S and a molecular weight of 292.44 g/mol. Its IUPAC name is (1S,2Z,7S,9R,13Z,15R,16S,17R)-8λ6-thiatetracyclo[13.2.1.07,17.09,16]octadeca-2,13-diene 8,8-dioxide.
| Compound Name | (1S,2Z,7S,9R,13Z,15R,16S,17R)-8λ6-thiatetracyclo[13.2.1.07,17.09,16]octadeca-2,13-diene 8,8-dioxide |
|---|---|
| PubChem CID | 155929175 |
| Molecular Formula | C17H24O2S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (1S,2Z,7S,9R,13Z,15R,16S,17R)-8λ6-thiatetracyclo[13.2.1.07,17.09,16]octadeca-2,13-diene 8,8-dioxide |
| SMILES | O=S1(=O)[C@@H]2CCC/C=C\[C@H]3C[C@H]4/C=C\CCC[C@H]1[C@H]4[C@@H]23 |
| InChI | InChI=1S/C17H24O2S/c18-20(19)14-9-5-1-3-7-12-11-13-8-4-2-6-10-15(20)17(13)16(12)14/h3-4,7-8,12-17H,1-2,5-6,9-11H2/b7-3-,8-4-/t12-,13+,14+,15-,16+,17- |
| InChIKey | AUTYTGSEWLEUND-CEHGPWPFSA-N |
| XLogP | 3.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|