C21H32O2S — CID 155929172
(1S,3R,3aS,4R,6S,6aR)-4,6-bis(ethenyl)-1,3-bis(pent-4-enyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophene 2,2-dioxide (PubChem CID 155929172) has the molecular formula C21H32O2S and a molecular weight of 348.55 g/mol. Its IUPAC name is (1S,3R,3aS,4R,6S,6aR)-4,6-bis(ethenyl)-1,3-bis(pent-4-enyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophene 2,2-dioxide.
| Compound Name | (1S,3R,3aS,4R,6S,6aR)-4,6-bis(ethenyl)-1,3-bis(pent-4-enyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophene 2,2-dioxide |
|---|---|
| PubChem CID | 155929172 |
| Molecular Formula | C21H32O2S |
| Molecular Weight | 348.55 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (1S,3R,3aS,4R,6S,6aR)-4,6-bis(ethenyl)-1,3-bis(pent-4-enyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophene 2,2-dioxide |
| SMILES | C=CCCC[C@@H]1[C@@H]2[C@@H]([C@H](C=C)C[C@@H]2C=C)[C@H](CCCC=C)S1(=O)=O |
| InChI | InChI=1S/C21H32O2S/c1-5-9-11-13-18-20-16(7-3)15-17(8-4)21(20)19(24(18,22)23)14-12-10-6-2/h5-8,16-21H,1-4,9-15H2/t16-,17+,18+,19-,20+,21- |
| InChIKey | MIHRWXMIGUDJNL-RFUSENCQSA-N |
| XLogP | 5.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|