C16H24O2S — CID 134887383
(3S)-3-[(E)-hept-1-enyl]-4λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 4,4-dioxide (PubChem CID 134887383) has the molecular formula C16H24O2S and a molecular weight of 280.43 g/mol. Its IUPAC name is (3S)-3-[(E)-hept-1-enyl]-4λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 4,4-dioxide.
| Compound Name | (3S)-3-[(E)-hept-1-enyl]-4λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 4,4-dioxide |
|---|---|
| PubChem CID | 134887383 |
| Molecular Formula | C16H24O2S |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (3S)-3-[(E)-hept-1-enyl]-4λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 4,4-dioxide |
| SMILES | CCCCC/C=C/C1C2C3C=CC(C3)C2CS1(=O)=O |
| InChI | InChI=1S/C16H24O2S/c1-2-3-4-5-6-7-15-16-13-9-8-12(10-13)14(16)11-19(15,17)18/h6-9,12-16H,2-5,10-11H2,1H3/b7-6+ |
| InChIKey | AMPDWRCDNURAPM-VOTSOKGWSA-N |
| XLogP | 3.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|