C9H12O2S — CID 21122530
(2R,6S)-4λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 4,4-dioxide (PubChem CID 21122530) has the molecular formula C9H12O2S and a molecular weight of 184.26 g/mol. Its IUPAC name is (2R,6S)-4λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 4,4-dioxide.
| Compound Name | (2R,6S)-4λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 4,4-dioxide |
|---|---|
| PubChem CID | 21122530 |
| Molecular Formula | C9H12O2S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | (2R,6S)-4λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 4,4-dioxide |
| SMILES | O=S1(=O)C[C@@H]2C3C=CC(C3)[C@@H]2C1 |
| InChI | InChI=1S/C9H12O2S/c10-12(11)4-8-6-1-2-7(3-6)9(8)5-12/h1-2,6-9H,3-5H2/t6?,7?,8-,9+ |
| InChIKey | QXFZZULXEGYJJE-WZENYGAOSA-N |
| XLogP | 0.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|