C9H12S — CID 155929167
(2S,6R)-4-thiatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 155929167) has the molecular formula C9H12S and a molecular weight of 152.26 g/mol. Its IUPAC name is (2S,6R)-4-thiatricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | (2S,6R)-4-thiatricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 155929167 |
| Molecular Formula | C9H12S |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | (2S,6R)-4-thiatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | C1=CC2CC1[C@H]1CSC[C@@H]21 |
| InChI | InChI=1S/C9H12S/c1-2-7-3-6(1)8-4-10-5-9(7)8/h1-2,6-9H,3-5H2/t6?,7?,8-,9+ |
| InChIKey | FKWKBPUUCQAMPI-WZENYGAOSA-N |
| XLogP | 2.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|