C19H28O2S — CID 155929170
(2S,3R,5S,6R)-3,5-bis(pent-4-enyl)-4λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 4,4-dioxide (PubChem CID 155929170) has the molecular formula C19H28O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is (2S,3R,5S,6R)-3,5-bis(pent-4-enyl)-4λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 4,4-dioxide.
| Compound Name | (2S,3R,5S,6R)-3,5-bis(pent-4-enyl)-4λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 4,4-dioxide |
|---|---|
| PubChem CID | 155929170 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (2S,3R,5S,6R)-3,5-bis(pent-4-enyl)-4λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 4,4-dioxide |
| SMILES | C=CCCC[C@@H]1[C@H]2C3C=CC(C3)[C@H]2[C@H](CCCC=C)S1(=O)=O |
| InChI | InChI=1S/C19H28O2S/c1-3-5-7-9-16-18-14-11-12-15(13-14)19(18)17(22(16,20)21)10-8-6-4-2/h3-4,11-12,14-19H,1-2,5-10,13H2/t14?,15?,16-,17+,18-,19+ |
| InChIKey | OUEAKJKWBLQICO-ZNJOBHTLSA-N |
| XLogP | 4.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|