C23H36O2S — CID 122205117
(1R,3S,3aR,4S,6R,6aS)-4,6-bis(ethenyl)-1,3-bis(hex-5-enyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophene 2,2-dioxide (PubChem CID 122205117) has the molecular formula C23H36O2S and a molecular weight of 376.61 g/mol. Its IUPAC name is (1R,3S,3aR,4S,6R,6aS)-4,6-bis(ethenyl)-1,3-bis(hex-5-enyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophene 2,2-dioxide.
| Compound Name | (1R,3S,3aR,4S,6R,6aS)-4,6-bis(ethenyl)-1,3-bis(hex-5-enyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophene 2,2-dioxide |
|---|---|
| PubChem CID | 122205117 |
| Molecular Formula | C23H36O2S |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (1R,3S,3aR,4S,6R,6aS)-4,6-bis(ethenyl)-1,3-bis(hex-5-enyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]thiophene 2,2-dioxide |
| SMILES | C=CCCCC[C@@H]1[C@@H]2[C@@H]([C@H](C=C)C[C@@H]2C=C)[C@H](CCCCC=C)S1(=O)=O |
| InChI | InChI=1S/C23H36O2S/c1-5-9-11-13-15-20-22-18(7-3)17-19(8-4)23(22)21(26(20,24)25)16-14-12-10-6-2/h5-8,18-23H,1-4,9-17H2/t18-,19+,20+,21-,22+,23- |
| InChIKey | BSUFUIDOCQAPDL-PVEVXQNYSA-N |
| XLogP | 5.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|