C16H22O2S — CID 155929174
(1S,3R,4R,5R,7S,11R)-5-ethenyl-5-methyl-3-prop-2-enyl-2λ6-thiatricyclo[5.3.1.04,11]undec-8-ene 2,2-dioxide (PubChem CID 155929174) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is (1S,3R,4R,5R,7S,11R)-5-ethenyl-5-methyl-3-prop-2-enyl-2λ6-thiatricyclo[5.3.1.04,11]undec-8-ene 2,2-dioxide.
| Compound Name | (1S,3R,4R,5R,7S,11R)-5-ethenyl-5-methyl-3-prop-2-enyl-2λ6-thiatricyclo[5.3.1.04,11]undec-8-ene 2,2-dioxide |
|---|---|
| PubChem CID | 155929174 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (1S,3R,4R,5R,7S,11R)-5-ethenyl-5-methyl-3-prop-2-enyl-2λ6-thiatricyclo[5.3.1.04,11]undec-8-ene 2,2-dioxide |
| SMILES | C=CC[C@@H]1[C@@H]2[C@H]3[C@H](C=CC[C@@H]3S1(=O)=O)C[C@]2(C)C=C |
| InChI | InChI=1S/C16H22O2S/c1-4-7-13-15-14-11(10-16(15,3)5-2)8-6-9-12(14)19(13,17)18/h4-6,8,11-15H,1-2,7,9-10H2,3H3/t11-,12+,13-,14+,15-,16+/m1/s1 |
| InChIKey | ARKNGOMFIAZXKD-TWHJKIGZSA-N |
| XLogP | 3.13 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|