C11H16O2S — CID 10059045
(1R,7S)-3λ6-thiatricyclo[5.3.2.02,6]dodec-11-ene 3,3-dioxide (PubChem CID 10059045) has the molecular formula C11H16O2S and a molecular weight of 212.31 g/mol. Its IUPAC name is (1R,7S)-3λ6-thiatricyclo[5.3.2.02,6]dodec-11-ene 3,3-dioxide.
| Compound Name | (1R,7S)-3λ6-thiatricyclo[5.3.2.02,6]dodec-11-ene 3,3-dioxide |
|---|---|
| PubChem CID | 10059045 |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | (1R,7S)-3λ6-thiatricyclo[5.3.2.02,6]dodec-11-ene 3,3-dioxide |
| SMILES | O=S1(=O)CCC2C1[C@H]1C=C[C@@H]2CCC1 |
| InChI | InChI=1S/C11H16O2S/c12-14(13)7-6-10-8-2-1-3-9(5-4-8)11(10)14/h4-5,8-11H,1-3,6-7H2/t8-,9+,10?,11?/m0/s1 |
| InChIKey | ZBETTXIOEXKYJY-IZUQBHJASA-N |
| XLogP | 1.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|