C12H17F3O2S — CID 58104805
5-[4-(trifluoromethylsulfonyl)butyl]bicyclo[2.2.1]hept-2-ene (PubChem CID 58104805) has the molecular formula C12H17F3O2S and a molecular weight of 282.33 g/mol. Its IUPAC name is 5-[4-(trifluoromethylsulfonyl)butyl]bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-[4-(trifluoromethylsulfonyl)butyl]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 58104805 |
| Molecular Formula | C12H17F3O2S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 5-[4-(trifluoromethylsulfonyl)butyl]bicyclo[2.2.1]hept-2-ene |
| SMILES | O=S(=O)(CCCCC1CC2C=CC1C2)C(F)(F)F |
| InChI | InChI=1S/C12H17F3O2S/c13-12(14,15)18(16,17)6-2-1-3-10-7-9-4-5-11(10)8-9/h4-5,9-11H,1-3,6-8H2 |
| InChIKey | CLOQHGHDCSTHTO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|