C8H9F2O3S- — CID 58108188
2-bicyclo[2.2.1]hept-5-enyl(difluoro)methanesulfonate (PubChem CID 58108188) has the molecular formula C8H9F2O3S- and a molecular weight of 223.22 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enyl(difluoro)methanesulfonate.
| Compound Name | 2-bicyclo[2.2.1]hept-5-enyl(difluoro)methanesulfonate |
|---|---|
| PubChem CID | 58108188 |
| Molecular Formula | C8H9F2O3S- |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enyl(difluoro)methanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C1CC2C=CC1C2 |
| InChI | InChI=1S/C8H10F2O3S/c9-8(10,14(11,12)13)7-4-5-1-2-6(7)3-5/h1-2,5-7H,3-4H2,(H,11,12,13)/p-1 |
| InChIKey | UPTHBUQPLABNSE-UHFFFAOYSA-M |
| XLogP | 1.34 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|