C11H14F3O3S- — CID 58445720
3-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1-trifluoro-2-methylpropane-2-sulfonate (PubChem CID 58445720) has the molecular formula C11H14F3O3S- and a molecular weight of 283.29 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1-trifluoro-2-methylpropane-2-sulfonate.
| Compound Name | 3-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1-trifluoro-2-methylpropane-2-sulfonate |
|---|---|
| PubChem CID | 58445720 |
| Molecular Formula | C11H14F3O3S- |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1-trifluoro-2-methylpropane-2-sulfonate |
| SMILES | CC(CC1CC2C=CC1C2)(C(F)(F)F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C11H15F3O3S/c1-10(11(12,13)14,18(15,16)17)6-9-5-7-2-3-8(9)4-7/h2-3,7-9H,4-6H2,1H3,(H,15,16,17)/p-1 |
| InChIKey | XRBIIUPFHKXLLH-UHFFFAOYSA-M |
| XLogP | 2.45 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|