C10H9F6O3S- — CID 58108194
2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3,3-hexafluoropropane-2-sulfonate (PubChem CID 58108194) has the molecular formula C10H9F6O3S- and a molecular weight of 323.23 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3,3-hexafluoropropane-2-sulfonate.
| Compound Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3,3-hexafluoropropane-2-sulfonate |
|---|---|
| PubChem CID | 58108194 |
| Molecular Formula | C10H9F6O3S- |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)-1,1,1,3,3,3-hexafluoropropane-2-sulfonate |
| SMILES | O=S(=O)([O-])C(C1CC2C=CC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10F6O3S/c11-9(12,13)8(10(14,15)16,20(17,18)19)7-4-5-1-2-6(7)3-5/h1-2,5-7H,3-4H2,(H,17,18,19)/p-1 |
| InChIKey | WGIWBJILGFATBH-UHFFFAOYSA-M |
| XLogP | 2.61 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|