C10H13F3O2S — CID 58104799
5-[2-(trifluoromethylsulfonyl)ethyl]bicyclo[2.2.1]hept-2-ene (PubChem CID 58104799) has the molecular formula C10H13F3O2S and a molecular weight of 254.27 g/mol. Its IUPAC name is 5-[2-(trifluoromethylsulfonyl)ethyl]bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-[2-(trifluoromethylsulfonyl)ethyl]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 58104799 |
| Molecular Formula | C10H13F3O2S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 5-[2-(trifluoromethylsulfonyl)ethyl]bicyclo[2.2.1]hept-2-ene |
| SMILES | O=S(=O)(CCC1CC2C=CC1C2)C(F)(F)F |
| InChI | InChI=1S/C10H13F3O2S/c11-10(12,13)16(14,15)4-3-9-6-7-1-2-8(9)5-7/h1-2,7-9H,3-6H2 |
| InChIKey | KCMCSIYHBDVMQZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|