C10H10F6O2S — CID 20811126
5-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 20811126) has the molecular formula C10H10F6O2S and a molecular weight of 308.24 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 20811126 |
| Molecular Formula | C10H10F6O2S |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-ylsulfonyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | O=S(=O)(C1CC2C=CC1C2)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10F6O2S/c11-9(12,13)8(10(14,15)16)19(17,18)7-4-5-1-2-6(7)3-5/h1-2,5-8H,3-4H2 |
| InChIKey | RCNOQSQMBOUKAU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|