C11H9F9O2S — CID 91285461
1-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 91285461) has the molecular formula C11H9F9O2S and a molecular weight of 376.24 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 91285461 |
| Molecular Formula | C11H9F9O2S |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | O=S(=O)(C12C=CC(CC1)C2)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H9F9O2S/c12-8(13,10(16,17)18)9(14,15)11(19,20)23(21,22)7-3-1-6(5-7)2-4-7/h1,3,6H,2,4-5H2 |
| InChIKey | DXIWSTUYJUTEAD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|