C13H20O4S2 — CID 4872857
6-butylsulfonyl-3λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 3,3-dioxide (PubChem CID 4872857) has the molecular formula C13H20O4S2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 6-butylsulfonyl-3λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 3,3-dioxide.
| Compound Name | 6-butylsulfonyl-3λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 3,3-dioxide |
|---|---|
| PubChem CID | 4872857 |
| Molecular Formula | C13H20O4S2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 6-butylsulfonyl-3λ6-thiatricyclo[5.2.1.02,6]dec-8-ene 3,3-dioxide |
| SMILES | CCCCS(=O)(=O)C12CCS(=O)(=O)C1C1C=CC2C1 |
| InChI | InChI=1S/C13H20O4S2/c1-2-3-7-19(16,17)13-6-8-18(14,15)12(13)10-4-5-11(13)9-10/h4-5,10-12H,2-3,6-9H2,1H3 |
| InChIKey | REWIUTOSFXGWLJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|