C8H12ClN — CID 54611381
tricyclo[3.2.1.02,4]oct-6-en-3-amine;hydrochloride (PubChem CID 54611381) has the molecular formula C8H12ClN and a molecular weight of 157.64 g/mol. Its IUPAC name is tricyclo[3.2.1.02,4]oct-6-en-3-amine;hydrochloride.
| Compound Name | tricyclo[3.2.1.02,4]oct-6-en-3-amine;hydrochloride |
|---|---|
| PubChem CID | 54611381 |
| Molecular Formula | C8H12ClN |
| Molecular Weight | 157.64 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | tricyclo[3.2.1.02,4]oct-6-en-3-amine;hydrochloride |
| SMILES | Cl.NC1C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C8H11N.ClH/c9-8-6-4-1-2-5(3-4)7(6)8;/h1-2,4-8H,3,9H2;1H |
| InChIKey | XSFJSNJYAVVKTQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.64 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|