C15H26O2Si2 — CID 13321235
trimethyl-[(4-trimethylsilyloxy-3-tricyclo[4.2.1.02,5]nona-3,7-dienyl)oxy]silane (PubChem CID 13321235) has the molecular formula C15H26O2Si2 and a molecular weight of 294.54 g/mol. Its IUPAC name is trimethyl-[(4-trimethylsilyloxy-3-tricyclo[4.2.1.02,5]nona-3,7-dienyl)oxy]silane.
| Compound Name | trimethyl-[(4-trimethylsilyloxy-3-tricyclo[4.2.1.02,5]nona-3,7-dienyl)oxy]silane |
|---|---|
| PubChem CID | 13321235 |
| Molecular Formula | C15H26O2Si2 |
| Molecular Weight | 294.54 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | trimethyl-[(4-trimethylsilyloxy-3-tricyclo[4.2.1.02,5]nona-3,7-dienyl)oxy]silane |
| SMILES | C[Si](C)(C)OC1=C(O[Si](C)(C)C)C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C15H26O2Si2/c1-18(2,3)16-14-12-10-7-8-11(9-10)13(12)15(14)17-19(4,5)6/h7-8,10-13H,9H2,1-6H3 |
| InChIKey | VGWBRZKYHYAIID-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|