C13H26O2Si2 — CID 155656357
2-bicyclo[2.2.1]hept-5-enylmethoxy-dimethyl-trimethylsilyloxysilane (PubChem CID 155656357) has the molecular formula C13H26O2Si2 and a molecular weight of 270.52 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enylmethoxy-dimethyl-trimethylsilyloxysilane.
| Compound Name | 2-bicyclo[2.2.1]hept-5-enylmethoxy-dimethyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 155656357 |
| Molecular Formula | C13H26O2Si2 |
| Molecular Weight | 270.52 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enylmethoxy-dimethyl-trimethylsilyloxysilane |
| SMILES | C[Si](C)(C)O[Si](C)(C)OCC1CC2C=CC1C2 |
| InChI | InChI=1S/C13H26O2Si2/c1-16(2,3)15-17(4,5)14-10-13-9-11-6-7-12(13)8-11/h6-7,11-13H,8-10H2,1-5H3 |
| InChIKey | LIMYACOHBITKDA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|