C27H54O2Si2 — CID 135036073
[(1S,3aR,4R,5S,7aS)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-7a-methyl-5-propan-2-yl-1,2,3,3a,4,5-hexahydroinden-4-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 135036073) has the molecular formula C27H54O2Si2 and a molecular weight of 466.90 g/mol. Its IUPAC name is [(1S,3aR,4R,5S,7aS)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-7a-methyl-5-propan-2-yl-1,2,3,3a,4,5-hexahydroinden-4-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,3aR,4R,5S,7aS)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-7a-methyl-5-propan-2-yl-1,2,3,3a,4,5-hexahydroinden-4-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 135036073 |
| Molecular Formula | C27H54O2Si2 |
| Molecular Weight | 466.90 g/mol |
| Exact Mass | 466.37 |
| IUPAC Name | [(1S,3aR,4R,5S,7aS)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-7a-methyl-5-propan-2-yl-1,2,3,3a,4,5-hexahydroinden-4-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)[C@H]1C=C[C@]2(C)[C@@H](CO[Si](C)(C)C(C)(C)C)CC[C@@H]2[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H54O2Si2/c1-20(2)22-16-17-27(9)21(18-28-30(10,11)25(3,4)5)14-15-24(27)23(22)19-29-31(12,13)26(6,7)8/h16-17,20-24H,14-15,18-19H2,1-13H3/t21-,22-,23-,24-,27-/m1/s1 |
| InChIKey | XCNPQZODROUPSX-XMPCBSOPSA-N |
| XLogP | 8.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.90 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|