C23H42O2Si2 — CID 10894797
tert-butyl-[[(1R,2S,3R,6S,7R,8S)-6-[tert-butyl(dimethyl)silyl]oxy-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]oxy]-dimethylsilane (PubChem CID 10894797) has the molecular formula C23H42O2Si2 and a molecular weight of 406.76 g/mol. Its IUPAC name is tert-butyl-[[(1R,2S,3R,6S,7R,8S)-6-[tert-butyl(dimethyl)silyl]oxy-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,2S,3R,6S,7R,8S)-6-[tert-butyl(dimethyl)silyl]oxy-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 10894797 |
| Molecular Formula | C23H42O2Si2 |
| Molecular Weight | 406.76 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | tert-butyl-[[(1R,2S,3R,6S,7R,8S)-6-[tert-butyl(dimethyl)silyl]oxy-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C23H42O2Si2/c1-22(2,3)26(7,8)24-18-13-14-19(25-27(9,10)23(4,5)6)21-17-12-11-16(15-17)20(18)21/h11-14,16-21H,15H2,1-10H3/t16-,17+,18+,19-,20+,21- |
| InChIKey | LIPINSGDVRESNC-RFUSENCQSA-N |
| XLogP | 6.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.76 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|