C14H22O2Si — CID 134969067
(1S,2S,3S,6R,7R,8R)-11-trimethylsilyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-diol (PubChem CID 134969067) has the molecular formula C14H22O2Si and a molecular weight of 250.41 g/mol. Its IUPAC name is (1S,2S,3S,6R,7R,8R)-11-trimethylsilyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-diol.
| Compound Name | (1S,2S,3S,6R,7R,8R)-11-trimethylsilyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-diol |
|---|---|
| PubChem CID | 134969067 |
| Molecular Formula | C14H22O2Si |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (1S,2S,3S,6R,7R,8R)-11-trimethylsilyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-diol |
| SMILES | C[Si](C)(C)C1[C@H]2C=C[C@@H]1[C@H]1[C@@H]2[C@@H](O)C=C[C@H]1O |
| InChI | InChI=1S/C14H22O2Si/c1-17(2,3)14-8-4-5-9(14)13-11(16)7-6-10(15)12(8)13/h4-16H,1-3H3/t8-,9+,10-,11+,12-,13+,14? |
| InChIKey | FTKHQKBNAHQHDH-KOLJQJQNSA-N |
| XLogP | 2.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|