C16H24O3Si — CID 134955893
[(1R,2R,3R,6S,7S,8S)-6-hydroxy-11-trimethylsilyl-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl] acetate (PubChem CID 134955893) has the molecular formula C16H24O3Si and a molecular weight of 292.45 g/mol. Its IUPAC name is [(1R,2R,3R,6S,7S,8S)-6-hydroxy-11-trimethylsilyl-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl] acetate.
| Compound Name | [(1R,2R,3R,6S,7S,8S)-6-hydroxy-11-trimethylsilyl-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl] acetate |
|---|---|
| PubChem CID | 134955893 |
| Molecular Formula | C16H24O3Si |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | [(1R,2R,3R,6S,7S,8S)-6-hydroxy-11-trimethylsilyl-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C[C@H](O)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1[Si](C)(C)C |
| InChI | InChI=1S/C16H24O3Si/c1-9(17)19-13-8-7-12(18)14-10-5-6-11(15(13)14)16(10)20(2,3)4/h5-8,10-16,18H,1-4H3/t10-,11+,12-,13+,14-,15+,16?/m0/s1 |
| InChIKey | HQVYZPNFOOPHAG-CUSGQVQISA-N |
| XLogP | 2.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|