C11H14O — CID 59471195
tricyclo[6.2.1.02,7]undeca-5,9-dien-4-ol (PubChem CID 59471195) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is tricyclo[6.2.1.02,7]undeca-5,9-dien-4-ol.
| Compound Name | tricyclo[6.2.1.02,7]undeca-5,9-dien-4-ol |
|---|---|
| PubChem CID | 59471195 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | tricyclo[6.2.1.02,7]undeca-5,9-dien-4-ol |
| SMILES | OC1C=CC2C3C=CC(C3)C2C1 |
| InChI | InChI=1S/C11H14O/c12-9-3-4-10-7-1-2-8(5-7)11(10)6-9/h1-4,7-12H,5-6H2 |
| InChIKey | IOIVOXNUSKVFAX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|