C34H68O3Si3 — CID 134872600
4-[(1R,2S,3S,3aR,4S,5R,7aS)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-ethenyl-2-methyl-2,3,3a,4,5,7a-hexahydro-1H-inden-5-yl]butan-2-yloxy-tert-butyl-dimethylsilane (PubChem CID 134872600) has the molecular formula C34H68O3Si3 and a molecular weight of 609.17 g/mol. Its IUPAC name is 4-[(1R,2S,3S,3aR,4S,5R,7aS)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-ethenyl-2-methyl-2,3,3a,4,5,7a-hexahydro-1H-inden-5-yl]butan-2-yloxy-tert-butyl-dimethylsilane.
| Compound Name | 4-[(1R,2S,3S,3aR,4S,5R,7aS)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-ethenyl-2-methyl-2,3,3a,4,5,7a-hexahydro-1H-inden-5-yl]butan-2-yloxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134872600 |
| Molecular Formula | C34H68O3Si3 |
| Molecular Weight | 609.17 g/mol |
| Exact Mass | 608.45 |
| IUPAC Name | 4-[(1R,2S,3S,3aR,4S,5R,7aS)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4-ethenyl-2-methyl-2,3,3a,4,5,7a-hexahydro-1H-inden-5-yl]butan-2-yloxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@@H]1[C@@H]2[C@H](C=C[C@H]1CCC(C)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H68O3Si3/c1-19-27-26(21-20-24(2)35-38(13,14)32(4,5)6)22-23-28-29(27)31(37-40(17,18)34(10,11)12)25(3)30(28)36-39(15,16)33(7,8)9/h19,22-31H,1,20-21H2,2-18H3/t24?,25-,26+,27-,28-,29+,30-,31+/m0/s1 |
| InChIKey | GOJXXNZHXFHFEP-GHIGFDFKSA-N |
| XLogP | 10.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.17 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|