C23H44O2Si — CID 139253915
[(1S,3S)-5-(cyclohexen-1-yl)-3-methoxy-2,2-dimethylcyclopentyl]oxy-tri(propan-2-yl)silane (PubChem CID 139253915) has the molecular formula C23H44O2Si and a molecular weight of 380.69 g/mol. Its IUPAC name is [(1S,3S)-5-(cyclohexen-1-yl)-3-methoxy-2,2-dimethylcyclopentyl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1S,3S)-5-(cyclohexen-1-yl)-3-methoxy-2,2-dimethylcyclopentyl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 139253915 |
| Molecular Formula | C23H44O2Si |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | [(1S,3S)-5-(cyclohexen-1-yl)-3-methoxy-2,2-dimethylcyclopentyl]oxy-tri(propan-2-yl)silane |
| SMILES | CO[C@H]1CC(C2=CCCCC2)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)C1(C)C |
| InChI | InChI=1S/C23H44O2Si/c1-16(2)26(17(3)4,18(5)6)25-22-20(19-13-11-10-12-14-19)15-21(24-9)23(22,7)8/h13,16-18,20-22H,10-12,14-15H2,1-9H3/t20?,21-,22-/m0/s1 |
| InChIKey | VCCPXTAVPUVPOK-QIFDKBNDSA-N |
| XLogP | 7.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|