C20H40O2Si — CID 139253910
[(1S,3S,5S)-3-methoxy-2,2-dimethyl-5-prop-1-en-2-ylcyclopentyl]oxy-tri(propan-2-yl)silane (PubChem CID 139253910) has the molecular formula C20H40O2Si and a molecular weight of 340.62 g/mol. Its IUPAC name is [(1S,3S,5S)-3-methoxy-2,2-dimethyl-5-prop-1-en-2-ylcyclopentyl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1S,3S,5S)-3-methoxy-2,2-dimethyl-5-prop-1-en-2-ylcyclopentyl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 139253910 |
| Molecular Formula | C20H40O2Si |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | [(1S,3S,5S)-3-methoxy-2,2-dimethyl-5-prop-1-en-2-ylcyclopentyl]oxy-tri(propan-2-yl)silane |
| SMILES | C=C(C)[C@@H]1C[C@H](OC)C(C)(C)[C@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H40O2Si/c1-13(2)17-12-18(21-11)20(9,10)19(17)22-23(14(3)4,15(5)6)16(7)8/h14-19H,1,12H2,2-11H3/t17-,18-,19-/m0/s1 |
| InChIKey | NNIXAQCIOWMNTF-FHWLQOOXSA-N |
| XLogP | 6.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|